C13H17NO4S — CID 43238728
3-hydroxy-2-(3-phenylsulfanylpropanoylamino)butanoic acid (PubChem CID 43238728) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-hydroxy-2-(3-phenylsulfanylpropanoylamino)butanoic acid.
| Compound Name | 3-hydroxy-2-(3-phenylsulfanylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 43238728 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-hydroxy-2-(3-phenylsulfanylpropanoylamino)butanoic acid |
| SMILES | CC(O)C(NC(=O)CCSc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17NO4S/c1-9(15)12(13(17)18)14-11(16)7-8-19-10-5-3-2-4-6-10/h2-6,9,12,15H,7-8H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | WZBXQAXREONBLC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |