C17H24N2O5 — CID 70540033
diethyl (2S)-2-[[2-(methylamino)benzoyl]amino]pentanedioate (PubChem CID 70540033) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is diethyl (2S)-2-[[2-(methylamino)benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[2-(methylamino)benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 70540033 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | diethyl (2S)-2-[[2-(methylamino)benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccccc1NC)C(=O)OCC |
| InChI | InChI=1S/C17H24N2O5/c1-4-23-15(20)11-10-14(17(22)24-5-2)19-16(21)12-8-6-7-9-13(12)18-3/h6-9,14,18H,4-5,10-11H2,1-3H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | OBOHIWSCSNHNCI-AWEZNQCLSA-N |
| XLogP | 1.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |