C14H18BrNO5S — CID 75164214
diethyl 2-[(5-bromothiophene-2-carbonyl)amino]pentanedioate (PubChem CID 75164214) has the molecular formula C14H18BrNO5S and a molecular weight of 392.27 g/mol. Its IUPAC name is diethyl 2-[(5-bromothiophene-2-carbonyl)amino]pentanedioate.
| Compound Name | diethyl 2-[(5-bromothiophene-2-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 75164214 |
| Molecular Formula | C14H18BrNO5S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | diethyl 2-[(5-bromothiophene-2-carbonyl)amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(Br)s1)C(=O)OCC |
| InChI | InChI=1S/C14H18BrNO5S/c1-3-20-12(17)8-5-9(14(19)21-4-2)16-13(18)10-6-7-11(15)22-10/h6-7,9H,3-5,8H2,1-2H3,(H,16,18) |
| InChIKey | YFEKGSCGFBEBDU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |