C10H11BrN2O4S — CID 43176070
5-amino-2-[(5-bromothiophene-2-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 43176070) has the molecular formula C10H11BrN2O4S and a molecular weight of 335.18 g/mol. Its IUPAC name is 5-amino-2-[(5-bromothiophene-2-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(5-bromothiophene-2-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43176070 |
| Molecular Formula | C10H11BrN2O4S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5-amino-2-[(5-bromothiophene-2-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)c1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H11BrN2O4S/c11-7-3-2-6(18-7)9(15)13-5(10(16)17)1-4-8(12)14/h2-3,5H,1,4H2,(H2,12,14)(H,13,15)(H,16,17) |
| InChIKey | ONWVRLJIXKSYEH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |