C10H11ClN2O4S — CID 61144475
(2S)-5-amino-2-[(5-chlorothiophene-2-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 61144475) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is (2S)-5-amino-2-[(5-chlorothiophene-2-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(5-chlorothiophene-2-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61144475 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (2S)-5-amino-2-[(5-chlorothiophene-2-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)c1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C10H11ClN2O4S/c11-7-3-2-6(18-7)9(15)13-5(10(16)17)1-4-8(12)14/h2-3,5H,1,4H2,(H2,12,14)(H,13,15)(H,16,17)/t5-/m0/s1 |
| InChIKey | ZHVBMYMUOWBMQH-YFKPBYRVSA-N |
| XLogP | 0.85 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |