C10H11ClN4O4 — CID 114037303
(2R)-5-amino-2-[(6-chloropyridazine-3-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 114037303) has the molecular formula C10H11ClN4O4 and a molecular weight of 286.67 g/mol. Its IUPAC name is (2R)-5-amino-2-[(6-chloropyridazine-3-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[(6-chloropyridazine-3-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 114037303 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2R)-5-amino-2-[(6-chloropyridazine-3-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)c1ccc(Cl)nn1)C(=O)O |
| InChI | InChI=1S/C10H11ClN4O4/c11-7-3-1-5(14-15-7)9(17)13-6(10(18)19)2-4-8(12)16/h1,3,6H,2,4H2,(H2,12,16)(H,13,17)(H,18,19)/t6-/m1/s1 |
| InChIKey | GXVDKASZFSVYOX-ZCFIWIBFSA-N |
| XLogP | -0.42 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |