C12H13IN2O4 — CID 43084994
5-amino-2-[(4-iodobenzoyl)amino]-5-oxopentanoic acid (PubChem CID 43084994) has the molecular formula C12H13IN2O4 and a molecular weight of 376.15 g/mol. Its IUPAC name is 5-amino-2-[(4-iodobenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(4-iodobenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43084994 |
| Molecular Formula | C12H13IN2O4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 5-amino-2-[(4-iodobenzoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)c1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C12H13IN2O4/c13-8-3-1-7(2-4-8)11(17)15-9(12(18)19)5-6-10(14)16/h1-4,9H,5-6H2,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | FQZVHLZDFWFMTA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|