C11H15N3O4 — CID 110834835
(2S)-5-amino-2-[(1-methylpyrrole-3-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 110834835) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is (2S)-5-amino-2-[(1-methylpyrrole-3-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(1-methylpyrrole-3-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110834835 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S)-5-amino-2-[(1-methylpyrrole-3-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | Cn1ccc(C(=O)N[C@@H](CCC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C11H15N3O4/c1-14-5-4-7(6-14)10(16)13-8(11(17)18)2-3-9(12)15/h4-6,8H,2-3H2,1H3,(H2,12,15)(H,13,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | IEJAEFPBTUNJEM-QMMMGPOBSA-N |
| XLogP | -0.53 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |