C20H22N2O6 — CID 67332121
(2S)-5-amino-2-[(3,5-dimethoxy-4-phenylbenzoyl)amino]-5-oxopentanoic acid (PubChem CID 67332121) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2S)-5-amino-2-[(3,5-dimethoxy-4-phenylbenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(3,5-dimethoxy-4-phenylbenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67332121 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2S)-5-amino-2-[(3,5-dimethoxy-4-phenylbenzoyl)amino]-5-oxopentanoic acid |
| SMILES | COc1cc(C(=O)N[C@@H](CCC(N)=O)C(=O)O)cc(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C20H22N2O6/c1-27-15-10-13(19(24)22-14(20(25)26)8-9-17(21)23)11-16(28-2)18(15)12-6-4-3-5-7-12/h3-7,10-11,14H,8-9H2,1-2H3,(H2,21,23)(H,22,24)(H,25,26)/t14-/m0/s1 |
| InChIKey | BOYWXRAEASFGEM-AWEZNQCLSA-N |
| XLogP | 1.82 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |