2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid

C15H21NO5 — CID 43630471

IUPAC2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid
SMILESCCCC(NC(=O)c1cc(OC)c(C)c(OC)c1)C(=O)O
InChIInChI=1S/C15H21NO5/c1-5-6-11(15(18)19)16-14(17)10-7-12(20-3)9(2)13(8-10)21-4/h7-8,11H,5-6H2,1-4H3,(H,16,17)(H,18,19)
InChIKeySONDWRYYJOASKS-UHFFFAOYSA-N
MW295.34 g/mol
LogP2.00
Rot. Bonds7

About 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid

2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid (PubChem CID 43630471) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid.

Molecular Properties

Compound Name2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid
PubChem CID43630471
Molecular FormulaC15H21NO5
Molecular Weight295.34 g/mol
Exact Mass295.14
IUPAC Name2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid
SMILESCCCC(NC(=O)c1cc(OC)c(C)c(OC)c1)C(=O)O
InChIInChI=1S/C15H21NO5/c1-5-6-11(15(18)19)16-14(17)10-7-12(20-3)9(2)13(8-10)21-4/h7-8,11H,5-6H2,1-4H3,(H,16,17)(H,18,19)
InChIKeySONDWRYYJOASKS-UHFFFAOYSA-N
XLogP2.00
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.34
LogP ≤ 52.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid?
The IUPAC name of 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid (CID 43630471) is 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid.
What is the SMILES notation for 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid?
The canonical SMILES for 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid is CCCC(NC(=O)c1cc(OC)c(C)c(OC)c1)C(=O)O.
What is the InChIKey of 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid?
The InChIKey is SONDWRYYJOASKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5/c1-5-6-11(15(18)19)16-14(17)10-7-12(20-3)9(2)13(8-10)21-4/h7-8,11H,5-6H2,1-4H3,(H,16,17)(H,18,19).
What are the key properties of 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid?
2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid has a molecular weight of 295.34 g/mol, XLogP of 2.00, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethoxy-4-methylbenzoyl)amino]pentanoic acid is sourced from PubChem (CID 43630471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).