C17H24N2O6 — CID 120614500
(2S)-2-[(3-acetamido-4,5-dimethoxybenzoyl)amino]hexanoic acid (PubChem CID 120614500) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2S)-2-[(3-acetamido-4,5-dimethoxybenzoyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(3-acetamido-4,5-dimethoxybenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120614500 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (2S)-2-[(3-acetamido-4,5-dimethoxybenzoyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1cc(NC(C)=O)c(OC)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C17H24N2O6/c1-5-6-7-12(17(22)23)19-16(21)11-8-13(18-10(2)20)15(25-4)14(9-11)24-3/h8-9,12H,5-7H2,1-4H3,(H,18,20)(H,19,21)(H,22,23)/t12-/m0/s1 |
| InChIKey | DYBGRARJTYAIGL-LBPRGKRZSA-N |
| XLogP | 2.04 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |