C16H23NO6 — CID 16772294
4-methyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid (PubChem CID 16772294) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-methyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid.
| Compound Name | 4-methyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 16772294 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-methyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid |
| SMILES | COc1cc(C(=O)NC(CC(C)C)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C16H23NO6/c1-9(2)6-11(16(19)20)17-15(18)10-7-12(21-3)14(23-5)13(8-10)22-4/h7-9,11H,6H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | UCOFFKFPVPCXPY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |