C15H23NO4 — CID 92527695
3,4,5-trimethoxy-N-[(2S)-3-methylbutan-2-yl]benzamide (PubChem CID 92527695) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(2S)-3-methylbutan-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(2S)-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 92527695 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(2S)-3-methylbutan-2-yl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H](C)C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H23NO4/c1-9(2)10(3)16-15(17)11-7-12(18-4)14(20-6)13(8-11)19-5/h7-10H,1-6H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | XEYDMEXOIHYCJY-JTQLQIEISA-N |
| XLogP | 2.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |