C14H18N2O4 — CID 62090267
N-(1-cyanopropan-2-yl)-3,4,5-trimethoxybenzamide (PubChem CID 62090267) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(1-cyanopropan-2-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 62090267 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)CC#N)cc(OC)c1OC |
| InChI | InChI=1S/C14H18N2O4/c1-9(5-6-15)16-14(17)10-7-11(18-2)13(20-4)12(8-10)19-3/h7-9H,5H2,1-4H3,(H,16,17) |
| InChIKey | SBVPDMSZGKTFMV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |