C14H20BrNO4 — CID 83178838
N-(4-bromobutan-2-yl)-3,4,5-trimethoxybenzamide (PubChem CID 83178838) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is N-(4-bromobutan-2-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(4-bromobutan-2-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 83178838 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(4-bromobutan-2-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)CCBr)cc(OC)c1OC |
| InChI | InChI=1S/C14H20BrNO4/c1-9(5-6-15)16-14(17)10-7-11(18-2)13(20-4)12(8-10)19-3/h7-9H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | JUXMTKISQWNRPS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|