C14H22N2O4 — CID 103512763
3,4,5-trimethoxy-N-[2-(methylamino)propyl]benzamide (PubChem CID 103512763) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-(methylamino)propyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 103512763 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-(methylamino)propyl]benzamide |
| SMILES | CNC(C)CNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-9(15-2)8-16-14(17)10-6-11(18-3)13(20-5)12(7-10)19-4/h6-7,9,15H,8H2,1-5H3,(H,16,17) |
| InChIKey | VSQNYYBUCMRQOK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |