C14H20N2O6 — CID 108570777
methyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate (PubChem CID 108570777) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108570777 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | methyl N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O6/c1-19-10-7-9(8-11(20-2)12(10)21-3)13(17)15-5-6-16-14(18)22-4/h7-8H,5-6H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | KBXUEBDLAIYVAR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|