C22H30N2O7 — CID 5133336
3,4,5-trimethoxy-N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]benzamide (PubChem CID 5133336) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 5133336 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1CNCCNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O7/c1-26-16-12-18(28-3)17(27-2)11-15(16)13-23-7-8-24-22(25)14-9-19(29-4)21(31-6)20(10-14)30-5/h9-12,23H,7-8,13H2,1-6H3,(H,24,25) |
| InChIKey | JXJBFSQLUYTHBQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|