C20H26N2O7 — CID 110182047
N-[(2-amino-3,4,5-trimethoxyphenyl)methyl]-3,4,5-trimethoxybenzamide (PubChem CID 110182047) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[(2-amino-3,4,5-trimethoxyphenyl)methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2-amino-3,4,5-trimethoxyphenyl)methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 110182047 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(2-amino-3,4,5-trimethoxyphenyl)methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2cc(OC)c(OC)c(OC)c2N)cc(OC)c1OC |
| InChI | InChI=1S/C20H26N2O7/c1-24-13-7-11(8-14(25-2)17(13)27-4)20(23)22-10-12-9-15(26-3)18(28-5)19(29-6)16(12)21/h7-9H,10,21H2,1-6H3,(H,22,23) |
| InChIKey | BRBRYWOLRVVLKS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|