C17H18ClNO4 — CID 2713221
3-chloro-4,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzamide (PubChem CID 2713221) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 2713221 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-[(2-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccccc1CNC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H18ClNO4/c1-21-14-7-5-4-6-11(14)10-19-17(20)12-8-13(18)16(23-3)15(9-12)22-2/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | JYRLYOSWSMWGRC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |