C19H21Cl2NO3 — CID 7973201
4-butoxy-3-chloro-N-[(2-chlorophenyl)methyl]-5-methoxybenzamide (PubChem CID 7973201) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 4-butoxy-3-chloro-N-[(2-chlorophenyl)methyl]-5-methoxybenzamide.
| Compound Name | 4-butoxy-3-chloro-N-[(2-chlorophenyl)methyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 7973201 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-butoxy-3-chloro-N-[(2-chlorophenyl)methyl]-5-methoxybenzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)NCc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C19H21Cl2NO3/c1-3-4-9-25-18-16(21)10-14(11-17(18)24-2)19(23)22-12-13-7-5-6-8-15(13)20/h5-8,10-11H,3-4,9,12H2,1-2H3,(H,22,23) |
| InChIKey | CIVJITKAZVSCKX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|