C21H26ClNO2 — CID 17194170
N-[(2-chlorophenyl)methyl]-4-heptoxybenzamide (PubChem CID 17194170) has the molecular formula C21H26ClNO2 and a molecular weight of 359.90 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-heptoxybenzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 17194170 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H26ClNO2/c1-2-3-4-5-8-15-25-19-13-11-17(12-14-19)21(24)23-16-18-9-6-7-10-20(18)22/h6-7,9-14H,2-5,8,15-16H2,1H3,(H,23,24) |
| InChIKey | HSFMSTZKWDGQNK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|