C28H32N2O5 — CID 4952932
4-hexoxy-N'-[4-(2-phenoxyethoxy)benzoyl]benzohydrazide (PubChem CID 4952932) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 4-hexoxy-N'-[4-(2-phenoxyethoxy)benzoyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[4-(2-phenoxyethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 4952932 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-hexoxy-N'-[4-(2-phenoxyethoxy)benzoyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)c2ccc(OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N2O5/c1-2-3-4-8-19-33-25-15-11-22(12-16-25)27(31)29-30-28(32)23-13-17-26(18-14-23)35-21-20-34-24-9-6-5-7-10-24/h5-7,9-18H,2-4,8,19-21H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | QYENTJMVTRYWLM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|