C20H24N2O4 — CID 5223816
N'-(4-hexoxybenzoyl)-2-hydroxybenzohydrazide (PubChem CID 5223816) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N'-(4-hexoxybenzoyl)-2-hydroxybenzohydrazide.
| Compound Name | N'-(4-hexoxybenzoyl)-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 5223816 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N'-(4-hexoxybenzoyl)-2-hydroxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-2-3-4-7-14-26-16-12-10-15(11-13-16)19(24)21-22-20(25)17-8-5-6-9-18(17)23/h5-6,8-13,23H,2-4,7,14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | QRXAFKYBDJBGIO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|