C16H25N3O2S — CID 86177664
[(4-octoxybenzoyl)amino]thiourea (PubChem CID 86177664) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is [(4-octoxybenzoyl)amino]thiourea.
| Compound Name | [(4-octoxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 86177664 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [(4-octoxybenzoyl)amino]thiourea |
| SMILES | CCCCCCCCOc1ccc(C(=O)NNC(N)=S)cc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-3-4-5-6-7-12-21-14-10-8-13(9-11-14)15(20)18-19-16(17)22/h8-11H,2-7,12H2,1H3,(H,18,20)(H3,17,19,22) |
| InChIKey | DQDXPNNQNVWQMQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|