About 4-pentoxybenzohydrazide
4-pentoxybenzohydrazide (PubChem CID 2727702) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-pentoxybenzohydrazide.
Molecular Properties
| Compound Name | 4-pentoxybenzohydrazide |
| PubChem CID | 2727702 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-pentoxybenzohydrazide |
| SMILES | CCCCCOc1ccc(C(=O)NN)cc1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-4-9-16-11-7-5-10(6-8-11)12(15)14-13/h5-8H,2-4,9,13H2,1H3,(H,14,15) |
| InChIKey | ZJYYDMKIBGAUCA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-pentoxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentoxybenzohydrazide?
The IUPAC name of 4-pentoxybenzohydrazide (CID 2727702) is 4-pentoxybenzohydrazide.
What is the SMILES notation for 4-pentoxybenzohydrazide?
The canonical SMILES for 4-pentoxybenzohydrazide is CCCCCOc1ccc(C(=O)NN)cc1.
What is the InChIKey of 4-pentoxybenzohydrazide?
The InChIKey is ZJYYDMKIBGAUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-2-3-4-9-16-11-7-5-10(6-8-11)12(15)14-13/h5-8H,2-4,9,13H2,1H3,(H,14,15).
What are the key properties of 4-pentoxybenzohydrazide?
4-pentoxybenzohydrazide has a molecular weight of 222.29 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentoxybenzohydrazide is sourced from PubChem (CID 2727702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).