About 3-hexoxybenzohydrazide
3-hexoxybenzohydrazide (PubChem CID 54793158) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-hexoxybenzohydrazide.
Molecular Properties
| Compound Name | 3-hexoxybenzohydrazide |
| PubChem CID | 54793158 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-3-4-5-9-17-12-8-6-7-11(10-12)13(16)15-14/h6-8,10H,2-5,9,14H2,1H3,(H,15,16) |
| InChIKey | CIFXRGHOUIKPHC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxybenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxybenzohydrazide?
The IUPAC name of 3-hexoxybenzohydrazide (CID 54793158) is 3-hexoxybenzohydrazide.
What is the SMILES notation for 3-hexoxybenzohydrazide?
The canonical SMILES for 3-hexoxybenzohydrazide is CCCCCCOc1cccc(C(=O)NN)c1.
What is the InChIKey of 3-hexoxybenzohydrazide?
The InChIKey is CIFXRGHOUIKPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-2-3-4-5-9-17-12-8-6-7-11(10-12)13(16)15-14/h6-8,10H,2-5,9,14H2,1H3,(H,15,16).
What are the key properties of 3-hexoxybenzohydrazide?
3-hexoxybenzohydrazide has a molecular weight of 236.31 g/mol, XLogP of 2.25, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxybenzohydrazide is sourced from PubChem (CID 54793158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).