About methyl 3-octoxybenzoate
methyl 3-octoxybenzoate (PubChem CID 72706029) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl 3-octoxybenzoate.
Molecular Properties
| Compound Name | methyl 3-octoxybenzoate |
| PubChem CID | 72706029 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 3-octoxybenzoate |
| SMILES | CCCCCCCCOc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H24O3/c1-3-4-5-6-7-8-12-19-15-11-9-10-14(13-15)16(17)18-2/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | HFSFJXDYDUKYCA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-octoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-octoxybenzoate?
The IUPAC name of methyl 3-octoxybenzoate (CID 72706029) is methyl 3-octoxybenzoate.
What is the SMILES notation for methyl 3-octoxybenzoate?
The canonical SMILES for methyl 3-octoxybenzoate is CCCCCCCCOc1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-octoxybenzoate?
The InChIKey is HFSFJXDYDUKYCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-3-4-5-6-7-8-12-19-15-11-9-10-14(13-15)16(17)18-2/h9-11,13H,3-8,12H2,1-2H3.
What are the key properties of methyl 3-octoxybenzoate?
methyl 3-octoxybenzoate has a molecular weight of 264.37 g/mol, XLogP of 4.21, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-octoxybenzoate is sourced from PubChem (CID 72706029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).