C55H79ClO8 — CID 160948872
methyl 3-[(Z)-undec-4-enoxy]benzoate;3-[(Z)-undec-4-enoxy]benzoic acid;3-[(Z)-undec-4-enoxy]benzoyl chloride (PubChem CID 160948872) has the molecular formula C55H79ClO8 and a molecular weight of 903.68 g/mol. Its IUPAC name is methyl 3-[(Z)-undec-4-enoxy]benzoate;3-[(Z)-undec-4-enoxy]benzoic acid;3-[(Z)-undec-4-enoxy]benzoyl chloride.
| Compound Name | methyl 3-[(Z)-undec-4-enoxy]benzoate;3-[(Z)-undec-4-enoxy]benzoic acid;3-[(Z)-undec-4-enoxy]benzoyl chloride |
|---|---|
| PubChem CID | 160948872 |
| Molecular Formula | C55H79ClO8 |
| Molecular Weight | 903.68 g/mol |
| Exact Mass | 902.55 |
| IUPAC Name | methyl 3-[(Z)-undec-4-enoxy]benzoate;3-[(Z)-undec-4-enoxy]benzoic acid;3-[(Z)-undec-4-enoxy]benzoyl chloride |
| SMILES | CCCCCC/C=C\CCCOc1cccc(C(=O)Cl)c1.CCCCCC/C=C\CCCOc1cccc(C(=O)O)c1.CCCCCC/C=C\CCCOc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H28O3.C18H25ClO2.C18H26O3/c1-3-4-5-6-7-8-9-10-11-15-22-18-14-12-13-17(16-18)19(20)21-2;2*1-2-3-4-5-6-7-8-9-10-14-21-17-13-11-12-16(15-17)18(19)20/h8-9,12-14,16H,3-7,10-11,15H2,1-2H3;7-8,11-13,15H,2-6,9-10,14H2,1H3;7-8,11-13,15H,2-6,9-10,14H2,1H3,(H,19,20)/b9-8-;2*8-7- |
| InChIKey | SVMJEIQUBYSDSD-UJSHPDCMSA-N |
| XLogP | 15.98 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.68 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|