About methyl 3-ethoxybenzoate
methyl 3-ethoxybenzoate (PubChem CID 3267781) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is methyl 3-ethoxybenzoate.
Molecular Properties
| Compound Name | methyl 3-ethoxybenzoate |
| PubChem CID | 3267781 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | methyl 3-ethoxybenzoate |
| SMILES | CCOc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C10H12O3/c1-3-13-9-6-4-5-8(7-9)10(11)12-2/h4-7H,3H2,1-2H3 |
| InChIKey | IFLQNIVRGRISMD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-ethoxybenzoate?
The IUPAC name of methyl 3-ethoxybenzoate (CID 3267781) is methyl 3-ethoxybenzoate.
What is the SMILES notation for methyl 3-ethoxybenzoate?
The canonical SMILES for methyl 3-ethoxybenzoate is CCOc1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-ethoxybenzoate?
The InChIKey is IFLQNIVRGRISMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-3-13-9-6-4-5-8(7-9)10(11)12-2/h4-7H,3H2,1-2H3.
What are the key properties of methyl 3-ethoxybenzoate?
methyl 3-ethoxybenzoate has a molecular weight of 180.20 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethoxybenzoate is sourced from PubChem (CID 3267781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).