About methyl 3-(2-iodoethoxy)benzoate
methyl 3-(2-iodoethoxy)benzoate (PubChem CID 10979673) has the molecular formula C10H11IO3
and a molecular weight of 306.10 g/mol. Its IUPAC name is methyl 3-(2-iodoethoxy)benzoate.
Molecular Properties
| Compound Name | methyl 3-(2-iodoethoxy)benzoate |
| PubChem CID | 10979673 |
| Molecular Formula | C10H11IO3 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | methyl 3-(2-iodoethoxy)benzoate |
| SMILES | COC(=O)c1cccc(OCCI)c1 |
| InChI | InChI=1S/C10H11IO3/c1-13-10(12)8-3-2-4-9(7-8)14-6-5-11/h2-4,7H,5-6H2,1H3 |
| InChIKey | NYECALBCMWCKJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2-iodoethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-iodoethoxy)benzoate?
The IUPAC name of methyl 3-(2-iodoethoxy)benzoate (CID 10979673) is methyl 3-(2-iodoethoxy)benzoate.
What is the SMILES notation for methyl 3-(2-iodoethoxy)benzoate?
The canonical SMILES for methyl 3-(2-iodoethoxy)benzoate is COC(=O)c1cccc(OCCI)c1.
What is the InChIKey of methyl 3-(2-iodoethoxy)benzoate?
The InChIKey is NYECALBCMWCKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO3/c1-13-10(12)8-3-2-4-9(7-8)14-6-5-11/h2-4,7H,5-6H2,1H3.
What are the key properties of methyl 3-(2-iodoethoxy)benzoate?
methyl 3-(2-iodoethoxy)benzoate has a molecular weight of 306.10 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-iodoethoxy)benzoate is sourced from PubChem (CID 10979673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).