About (3-acetamidophenyl) 3-ethoxybenzoate
(3-acetamidophenyl) 3-ethoxybenzoate (PubChem CID 780025) has the molecular formula C17H17NO4
and a molecular weight of 299.33 g/mol. Its IUPAC name is (3-acetamidophenyl) 3-ethoxybenzoate.
Molecular Properties
| Compound Name | (3-acetamidophenyl) 3-ethoxybenzoate |
| PubChem CID | 780025 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3-acetamidophenyl) 3-ethoxybenzoate |
| SMILES | CCOc1cccc(C(=O)Oc2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C17H17NO4/c1-3-21-15-8-4-6-13(10-15)17(20)22-16-9-5-7-14(11-16)18-12(2)19/h4-11H,3H2,1-2H3,(H,18,19) |
| InChIKey | UCYHTVHSSWFGLJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamidophenyl) 3-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamidophenyl) 3-ethoxybenzoate?
The IUPAC name of (3-acetamidophenyl) 3-ethoxybenzoate (CID 780025) is (3-acetamidophenyl) 3-ethoxybenzoate.
What is the SMILES notation for (3-acetamidophenyl) 3-ethoxybenzoate?
The canonical SMILES for (3-acetamidophenyl) 3-ethoxybenzoate is CCOc1cccc(C(=O)Oc2cccc(NC(C)=O)c2)c1.
What is the InChIKey of (3-acetamidophenyl) 3-ethoxybenzoate?
The InChIKey is UCYHTVHSSWFGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4/c1-3-21-15-8-4-6-13(10-15)17(20)22-16-9-5-7-14(11-16)18-12(2)19/h4-11H,3H2,1-2H3,(H,18,19).
What are the key properties of (3-acetamidophenyl) 3-ethoxybenzoate?
(3-acetamidophenyl) 3-ethoxybenzoate has a molecular weight of 299.33 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamidophenyl) 3-ethoxybenzoate is sourced from PubChem (CID 780025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).