About ethyl 3-acetamidobenzoate
ethyl 3-acetamidobenzoate (PubChem CID 700589) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is ethyl 3-acetamidobenzoate.
Molecular Properties
| Compound Name | ethyl 3-acetamidobenzoate |
| PubChem CID | 700589 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | ethyl 3-acetamidobenzoate |
| SMILES | CCOC(=O)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C11H13NO3/c1-3-15-11(14)9-5-4-6-10(7-9)12-8(2)13/h4-7H,3H2,1-2H3,(H,12,13) |
| InChIKey | LVOGEXYCOVAAIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-acetamidobenzoate?
The IUPAC name of ethyl 3-acetamidobenzoate (CID 700589) is ethyl 3-acetamidobenzoate.
What is the SMILES notation for ethyl 3-acetamidobenzoate?
The canonical SMILES for ethyl 3-acetamidobenzoate is CCOC(=O)c1cccc(NC(C)=O)c1.
What is the InChIKey of ethyl 3-acetamidobenzoate?
The InChIKey is LVOGEXYCOVAAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-3-15-11(14)9-5-4-6-10(7-9)12-8(2)13/h4-7H,3H2,1-2H3,(H,12,13).
What are the key properties of ethyl 3-acetamidobenzoate?
ethyl 3-acetamidobenzoate has a molecular weight of 207.23 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-acetamidobenzoate is sourced from PubChem (CID 700589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).