About ethyl 3-acetylbenzoate
ethyl 3-acetylbenzoate (PubChem CID 11298463) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is ethyl 3-acetylbenzoate.
Molecular Properties
| Compound Name | ethyl 3-acetylbenzoate |
| PubChem CID | 11298463 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | ethyl 3-acetylbenzoate |
| SMILES | CCOC(=O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C11H12O3/c1-3-14-11(13)10-6-4-5-9(7-10)8(2)12/h4-7H,3H2,1-2H3 |
| InChIKey | KHTGDCLCPJJWEY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-acetylbenzoate?
The IUPAC name of ethyl 3-acetylbenzoate (CID 11298463) is ethyl 3-acetylbenzoate.
What is the SMILES notation for ethyl 3-acetylbenzoate?
The canonical SMILES for ethyl 3-acetylbenzoate is CCOC(=O)c1cccc(C(C)=O)c1.
What is the InChIKey of ethyl 3-acetylbenzoate?
The InChIKey is KHTGDCLCPJJWEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-3-14-11(13)10-6-4-5-9(7-10)8(2)12/h4-7H,3H2,1-2H3.
What are the key properties of ethyl 3-acetylbenzoate?
ethyl 3-acetylbenzoate has a molecular weight of 192.21 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-acetylbenzoate is sourced from PubChem (CID 11298463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).