C29H24O7 — CID 67965026
2-O-[2-(6-acetylnaphthalene-2-carbonyl)oxyethyl] 6-O-ethyl naphthalene-2,6-dicarboxylate (PubChem CID 67965026) has the molecular formula C29H24O7 and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-O-[2-(6-acetylnaphthalene-2-carbonyl)oxyethyl] 6-O-ethyl naphthalene-2,6-dicarboxylate.
| Compound Name | 2-O-[2-(6-acetylnaphthalene-2-carbonyl)oxyethyl] 6-O-ethyl naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 67965026 |
| Molecular Formula | C29H24O7 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-O-[2-(6-acetylnaphthalene-2-carbonyl)oxyethyl] 6-O-ethyl naphthalene-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2cc(C(=O)OCCOC(=O)c3ccc4cc(C(C)=O)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C29H24O7/c1-3-34-27(31)24-9-7-23-17-26(11-8-22(23)15-24)29(33)36-13-12-35-28(32)25-10-6-20-14-19(18(2)30)4-5-21(20)16-25/h4-11,14-17H,3,12-13H2,1-2H3 |
| InChIKey | BFELYZXSDHGTMA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|