C24H24O6 — CID 58800513
2-[6-(2-methoxyethoxy)naphthalen-2-yl]oxyethyl 4-acetylbenzoate (PubChem CID 58800513) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[6-(2-methoxyethoxy)naphthalen-2-yl]oxyethyl 4-acetylbenzoate.
| Compound Name | 2-[6-(2-methoxyethoxy)naphthalen-2-yl]oxyethyl 4-acetylbenzoate |
|---|---|
| PubChem CID | 58800513 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[6-(2-methoxyethoxy)naphthalen-2-yl]oxyethyl 4-acetylbenzoate |
| SMILES | COCCOc1ccc2cc(OCCOC(=O)c3ccc(C(C)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C24H24O6/c1-17(25)18-3-5-19(6-4-18)24(26)30-14-13-29-23-10-8-20-15-22(28-12-11-27-2)9-7-21(20)16-23/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | APXDGHBOVSUKQW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|