C26H30O9 — CID 157029099
2-[2-[2-[2-(4-acetylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 4-acetylbenzoate (PubChem CID 157029099) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-acetylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 4-acetylbenzoate.
| Compound Name | 2-[2-[2-[2-(4-acetylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 4-acetylbenzoate |
|---|---|
| PubChem CID | 157029099 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-[2-[2-[2-(4-acetylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OCCOCCOCCOCCOC(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H30O9/c1-19(27)21-3-7-23(8-4-21)25(29)34-17-15-32-13-11-31-12-14-33-16-18-35-26(30)24-9-5-22(6-10-24)20(2)28/h3-10H,11-18H2,1-2H3 |
| InChIKey | JBIBASCBNAGRQN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|