C20H18O7 — CID 130308397
2-[2-(4-formylbenzoyl)oxyethoxy]ethyl 4-formylbenzoate (PubChem CID 130308397) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-[2-(4-formylbenzoyl)oxyethoxy]ethyl 4-formylbenzoate.
| Compound Name | 2-[2-(4-formylbenzoyl)oxyethoxy]ethyl 4-formylbenzoate |
|---|---|
| PubChem CID | 130308397 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[2-(4-formylbenzoyl)oxyethoxy]ethyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCCOCCOC(=O)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C20H18O7/c21-13-15-1-5-17(6-2-15)19(23)26-11-9-25-10-12-27-20(24)18-7-3-16(14-22)4-8-18/h1-8,13-14H,9-12H2 |
| InChIKey | YMGAKEDJVFESMH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|