C13H20O3 — CID 91069506
ethane;methyl 4-formylbenzoate (PubChem CID 91069506) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethane;methyl 4-formylbenzoate.
| Compound Name | ethane;methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 91069506 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethane;methyl 4-formylbenzoate |
| SMILES | CC.CC.COC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H8O3.2C2H6/c1-12-9(11)8-4-2-7(6-10)3-5-8;2*1-2/h2-6H,1H3;2*1-2H3 |
| InChIKey | MWDYHGMBELAKDZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|