C9H9NO3 — CID 166845078
methylamino 4-formylbenzoate (PubChem CID 166845078) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is methylamino 4-formylbenzoate.
| Compound Name | methylamino 4-formylbenzoate |
|---|---|
| PubChem CID | 166845078 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | methylamino 4-formylbenzoate |
| SMILES | CNOC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H9NO3/c1-10-13-9(12)8-4-2-7(6-11)3-5-8/h2-6,10H,1H3 |
| InChIKey | GPKHHBAGPGKQJT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|