C22H20N2O8 — CID 18229054
[2-[2-[[2-(4-formylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 18229054) has the molecular formula C22H20N2O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is [2-[2-[[2-(4-formylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[2-[[2-(4-formylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 18229054 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [2-[2-[[2-(4-formylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)NCCNC(=O)COC(=O)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O8/c25-11-15-1-5-17(6-2-15)21(29)31-13-19(27)23-9-10-24-20(28)14-32-22(30)18-7-3-16(12-26)4-8-18/h1-8,11-12H,9-10,13-14H2,(H,23,27)(H,24,28) |
| InChIKey | QAELZYBOYCWALU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|