C19H19NO6 — CID 71823659
[2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 71823659) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 71823659 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | COc1cccc(CNC(=O)COC(=O)c2ccc(C=O)cc2)c1OC |
| InChI | InChI=1S/C19H19NO6/c1-24-16-5-3-4-15(18(16)25-2)10-20-17(22)12-26-19(23)14-8-6-13(11-21)7-9-14/h3-9,11H,10,12H2,1-2H3,(H,20,22) |
| InChIKey | LVVYUUWWIBRCRP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|