C12H17NO4 — CID 47161214
N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyacetamide (PubChem CID 47161214) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyacetamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 47161214 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCc1cccc(OC)c1OC |
| InChI | InChI=1S/C12H17NO4/c1-15-8-11(14)13-7-9-5-4-6-10(16-2)12(9)17-3/h4-6H,7-8H2,1-3H3,(H,13,14) |
| InChIKey | FQHHRGRDZGGIMI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |