C25H26N2O6S — CID 2584776
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2584776) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2584776 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)NCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-3-27(21-10-5-4-6-11-21)34(30,31)22-15-13-19(14-16-22)25(29)33-18-24(28)26-17-20-9-7-8-12-23(20)32-2/h4-16H,3,17-18H2,1-2H3,(H,26,28) |
| InChIKey | CWYQZZKTLXCPPK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |