C25H25NO7S — CID 2587682
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2587682) has the molecular formula C25H25NO7S and a molecular weight of 483.54 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2587682 |
| Molecular Formula | C25H25NO7S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H25NO7S/c1-4-26(20-8-6-5-7-9-20)34(29,30)21-13-10-18(11-14-21)25(28)33-17-22(27)19-12-15-23(31-2)24(16-19)32-3/h5-16H,4,17H2,1-3H3 |
| InChIKey | IYQZFZCXWOEGJB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |