C24H24N2O5S — CID 2588136
[2-(benzylamino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2588136) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2588136 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O5S/c1-2-26(21-11-7-4-8-12-21)32(29,30)22-15-13-20(14-16-22)24(28)31-18-23(27)25-17-19-9-5-3-6-10-19/h3-16H,2,17-18H2,1H3,(H,25,27) |
| InChIKey | RCCRDGNPMARURB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |