C23H20F2N2O5S — CID 2587626
[2-(2,5-difluoroanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2587626) has the molecular formula C23H20F2N2O5S and a molecular weight of 474.49 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2587626 |
| Molecular Formula | C23H20F2N2O5S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C23H20F2N2O5S/c1-2-27(18-6-4-3-5-7-18)33(30,31)19-11-8-16(9-12-19)23(29)32-15-22(28)26-21-14-17(24)10-13-20(21)25/h3-14H,2,15H2,1H3,(H,26,28) |
| InChIKey | CHRUZGKHGSCYJZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |