C22H17ClF2N2O5S — CID 29155226
[2-(2,5-difluoroanilino)-2-oxoethyl] 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate (PubChem CID 29155226) has the molecular formula C22H17ClF2N2O5S and a molecular weight of 494.90 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 29155226 |
| Molecular Formula | C22H17ClF2N2O5S |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 3-[(3-chlorophenyl)-methylsulfamoyl]benzoate |
| SMILES | CN(c1cccc(Cl)c1)S(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C22H17ClF2N2O5S/c1-27(17-6-3-5-15(23)11-17)33(30,31)18-7-2-4-14(10-18)22(29)32-13-21(28)26-20-12-16(24)8-9-19(20)25/h2-12H,13H2,1H3,(H,26,28) |
| InChIKey | LOEIIOAEDVXYMY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |