C22H19FN2O5S — CID 18777850
[2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 18777850) has the molecular formula C22H19FN2O5S and a molecular weight of 442.47 g/mol. Its IUPAC name is [2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 18777850 |
| Molecular Formula | C22H19FN2O5S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | [2-[3-[methyl(phenyl)sulfamoyl]anilino]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C22H19FN2O5S/c1-25(19-10-3-2-4-11-19)31(28,29)20-12-6-9-18(14-20)24-21(26)15-30-22(27)16-7-5-8-17(23)13-16/h2-14H,15H2,1H3,(H,24,26) |
| InChIKey | RDQZYVQJDPRHQF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |