C22H18F2N2O5S — CID 36501143
[2-(3,5-difluoroanilino)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 36501143) has the molecular formula C22H18F2N2O5S and a molecular weight of 460.46 g/mol. Its IUPAC name is [2-(3,5-difluoroanilino)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(3,5-difluoroanilino)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 36501143 |
| Molecular Formula | C22H18F2N2O5S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | [2-(3,5-difluoroanilino)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C22H18F2N2O5S/c1-26(19-5-3-2-4-6-19)32(29,30)20-9-7-15(8-10-20)22(28)31-14-21(27)25-18-12-16(23)11-17(24)13-18/h2-13H,14H2,1H3,(H,25,27) |
| InChIKey | HLLZUSMKVQKUGR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |